C10H16N2O4 — CID 1089068
4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid (PubChem CID 1089068) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid.
| Compound Name | 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 1089068 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid |
| SMILES | CC1(C)C(=O)NCCN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-10(2)9(16)11-5-6-12(10)7(13)3-4-8(14)15/h3-6H2,1-2H3,(H,11,16)(H,14,15) |
| InChIKey | WECARCQDMIODCT-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |