4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid

C10H16N2O4 — CID 1089068

IUPAC4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid
SMILESCC1(C)C(=O)NCCN1C(=O)CCC(=O)O
InChIInChI=1S/C10H16N2O4/c1-10(2)9(16)11-5-6-12(10)7(13)3-4-8(14)15/h3-6H2,1-2H3,(H,11,16)(H,14,15)
InChIKeyWECARCQDMIODCT-UHFFFAOYSA-N
MW228.25 g/mol
LogP-0.41
Rot. Bonds3

About 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid

4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid (PubChem CID 1089068) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid
PubChem CID1089068
Molecular FormulaC10H16N2O4
Molecular Weight228.25 g/mol
Exact Mass228.11
IUPAC Name4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid
SMILESCC1(C)C(=O)NCCN1C(=O)CCC(=O)O
InChIInChI=1S/C10H16N2O4/c1-10(2)9(16)11-5-6-12(10)7(13)3-4-8(14)15/h3-6H2,1-2H3,(H,11,16)(H,14,15)
InChIKeyWECARCQDMIODCT-UHFFFAOYSA-N
XLogP-0.41
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 5-0.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid?
The IUPAC name of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid (CID 1089068) is 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid is CC1(C)C(=O)NCCN1C(=O)CCC(=O)O.
What is the InChIKey of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid?
The InChIKey is WECARCQDMIODCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c1-10(2)9(16)11-5-6-12(10)7(13)3-4-8(14)15/h3-6H2,1-2H3,(H,11,16)(H,14,15).
What are the key properties of 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid?
4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid has a molecular weight of 228.25 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoic acid is sourced from PubChem (CID 1089068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).