C16H22N2O2 — CID 108907580
1-cyclohexyl-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea (PubChem CID 108907580) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea.
| Compound Name | 1-cyclohexyl-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108907580 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-2-(4-methoxyphenyl)ethenyl]urea |
| SMILES | COc1ccc(/C=C/NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-20-15-9-7-13(8-10-15)11-12-17-16(19)18-14-5-3-2-4-6-14/h7-12,14H,2-6H2,1H3,(H2,17,18,19)/b12-11+ |
| InChIKey | NAIWWZNHBUHGMC-VAWYXSNFSA-N |
| XLogP | 3.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |