C10H19BrO3 — CID 10890828
tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanoate (PubChem CID 10890828) has the molecular formula C10H19BrO3 and a molecular weight of 267.16 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanoate.
| Compound Name | tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 10890828 |
| Molecular Formula | C10H19BrO3 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | tert-butyl (2S,3S)-2-bromo-3-hydroxy-4-methylpentanoate |
| SMILES | CC(C)[C@H](O)[C@H](Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19BrO3/c1-6(2)8(12)7(11)9(13)14-10(3,4)5/h6-8,12H,1-5H3/t7-,8-/m0/s1 |
| InChIKey | DGZRLIWPVTYLCC-YUMQZZPRSA-N |
| XLogP | 2.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|