C17H17ClN2O2 — CID 108908536
1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2-ethoxyphenyl)urea (PubChem CID 108908536) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 108908536 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)N/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-2-22-16-6-4-3-5-15(16)20-17(21)19-12-11-13-7-9-14(18)10-8-13/h3-12H,2H2,1H3,(H2,19,20,21)/b12-11+ |
| InChIKey | SQVHLTRKYGSYKY-VAWYXSNFSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |