C9H16N2O — CID 108909188
N-ethenyl-2-methylpiperidine-1-carboxamide (PubChem CID 108909188) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-ethenyl-2-methylpiperidine-1-carboxamide.
| Compound Name | N-ethenyl-2-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108909188 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-ethenyl-2-methylpiperidine-1-carboxamide |
| SMILES | C=CNC(=O)N1CCCCC1C |
| InChI | InChI=1S/C9H16N2O/c1-3-10-9(12)11-7-5-4-6-8(11)2/h3,8H,1,4-7H2,2H3,(H,10,12) |
| InChIKey | NDYJWEKRMBZWLO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |