About 1-butyl-3-undecylurea
1-butyl-3-undecylurea (PubChem CID 10890956) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-butyl-3-undecylurea.
Molecular Properties
| Compound Name | 1-butyl-3-undecylurea |
| PubChem CID | 10890956 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 1-butyl-3-undecylurea |
| SMILES | CCCCCCCCCCCNC(=O)NCCCC |
| InChI | InChI=1S/C16H34N2O/c1-3-5-7-8-9-10-11-12-13-15-18-16(19)17-14-6-4-2/h3-15H2,1-2H3,(H2,17,18,19) |
| InChIKey | AIIMROZTIDIIKO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-undecylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-undecylurea?
The IUPAC name of 1-butyl-3-undecylurea (CID 10890956) is 1-butyl-3-undecylurea.
What is the SMILES notation for 1-butyl-3-undecylurea?
The canonical SMILES for 1-butyl-3-undecylurea is CCCCCCCCCCCNC(=O)NCCCC.
What is the InChIKey of 1-butyl-3-undecylurea?
The InChIKey is AIIMROZTIDIIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O/c1-3-5-7-8-9-10-11-12-13-15-18-16(19)17-14-6-4-2/h3-15H2,1-2H3,(H2,17,18,19).
What are the key properties of 1-butyl-3-undecylurea?
1-butyl-3-undecylurea has a molecular weight of 270.46 g/mol, XLogP of 4.62, 13 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-undecylurea is sourced from PubChem (CID 10890956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).