C10H20N2O3 — CID 108909605
1,1-bis(2-methoxyethyl)-3-[(E)-prop-1-enyl]urea (PubChem CID 108909605) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,1-bis(2-methoxyethyl)-3-[(E)-prop-1-enyl]urea.
| Compound Name | 1,1-bis(2-methoxyethyl)-3-[(E)-prop-1-enyl]urea |
|---|---|
| PubChem CID | 108909605 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1,1-bis(2-methoxyethyl)-3-[(E)-prop-1-enyl]urea |
| SMILES | C/C=C/NC(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C10H20N2O3/c1-4-5-11-10(13)12(6-8-14-2)7-9-15-3/h4-5H,6-9H2,1-3H3,(H,11,13)/b5-4+ |
| InChIKey | DSJCYEWXDLFICG-SNAWJCMRSA-N |
| XLogP | 0.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |