C9H18N2O3 — CID 108909832
1,1-bis(2-hydroxyethyl)-3-(2-methylprop-1-enyl)urea (PubChem CID 108909832) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-(2-methylprop-1-enyl)urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-(2-methylprop-1-enyl)urea |
|---|---|
| PubChem CID | 108909832 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-(2-methylprop-1-enyl)urea |
| SMILES | CC(C)=CNC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H18N2O3/c1-8(2)7-10-9(14)11(3-5-12)4-6-13/h7,12-13H,3-6H2,1-2H3,(H,10,14) |
| InChIKey | WNUURHRSLRJJFY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |