About 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol
2-(4-nitrophenyl)-1,3-benzothiazol-6-ol (PubChem CID 10890999) has the molecular formula C13H8N2O3S
and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol |
| PubChem CID | 10890999 |
| Molecular Formula | C13H8N2O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccc(O)cc3s2)cc1 |
| InChI | InChI=1S/C13H8N2O3S/c16-10-5-6-11-12(7-10)19-13(14-11)8-1-3-9(4-2-8)15(17)18/h1-7,16H |
| InChIKey | GYQGDDBYYWQCAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol?
The IUPAC name of 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol (CID 10890999) is 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol is O=[N+]([O-])c1ccc(-c2nc3ccc(O)cc3s2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol?
The InChIKey is GYQGDDBYYWQCAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O3S/c16-10-5-6-11-12(7-10)19-13(14-11)8-1-3-9(4-2-8)15(17)18/h1-7,16H.
What are the key properties of 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol?
2-(4-nitrophenyl)-1,3-benzothiazol-6-ol has a molecular weight of 272.29 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-1,3-benzothiazol-6-ol is sourced from PubChem (CID 10890999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).