C8H16N2O — CID 108910320
1,1-diethyl-3-prop-1-en-2-ylurea (PubChem CID 108910320) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,1-diethyl-3-prop-1-en-2-ylurea.
| Compound Name | 1,1-diethyl-3-prop-1-en-2-ylurea |
|---|---|
| PubChem CID | 108910320 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1,1-diethyl-3-prop-1-en-2-ylurea |
| SMILES | C=C(C)NC(=O)N(CC)CC |
| InChI | InChI=1S/C8H16N2O/c1-5-10(6-2)8(11)9-7(3)4/h3,5-6H2,1-2,4H3,(H,9,11) |
| InChIKey | JTUKTSYZXSDJNU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |