About N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide
N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 108910537) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide |
| PubChem CID | 108910537 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | CC/C=C/NC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-4-5-6-12-11(14)13-7-9(2)15-10(3)8-13/h5-6,9-10H,4,7-8H2,1-3H3,(H,12,14)/b6-5+ |
| InChIKey | LWKIULYDHMMRGO-AATRIKPKSA-N |
| XLogP | 1.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide?
The IUPAC name of N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide (CID 108910537) is N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide.
What is the SMILES notation for N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide?
The canonical SMILES for N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide is CC/C=C/NC(=O)N1CC(C)OC(C)C1.
What is the InChIKey of N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide?
The InChIKey is LWKIULYDHMMRGO-AATRIKPKSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-4-5-6-12-11(14)13-7-9(2)15-10(3)8-13/h5-6,9-10H,4,7-8H2,1-3H3,(H,12,14)/b6-5+.
What are the key properties of N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide?
N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide has a molecular weight of 212.29 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-1-enyl]-2,6-dimethylmorpholine-4-carboxamide is sourced from PubChem (CID 108910537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).