About 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea
3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea (PubChem CID 108910574) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea |
| PubChem CID | 108910574 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea |
| SMILES | CC/C=C/NC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H18N2O3/c1-2-3-4-10-9(14)11(5-7-12)6-8-13/h3-4,12-13H,2,5-8H2,1H3,(H,10,14)/b4-3+ |
| InChIKey | KKXJUOUBZSJUIH-ONEGZZNKSA-N |
| XLogP | -0.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea?
The IUPAC name of 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea (CID 108910574) is 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea.
What is the SMILES notation for 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea?
The canonical SMILES for 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea is CC/C=C/NC(=O)N(CCO)CCO.
What is the InChIKey of 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea?
The InChIKey is KKXJUOUBZSJUIH-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-2-3-4-10-9(14)11(5-7-12)6-8-13/h3-4,12-13H,2,5-8H2,1H3,(H,10,14)/b4-3+.
What are the key properties of 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea?
3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea has a molecular weight of 202.25 g/mol, XLogP of -0.09, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-1-enyl]-1,1-bis(2-hydroxyethyl)urea is sourced from PubChem (CID 108910574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).