About 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea
3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea (PubChem CID 108910719) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea.
Molecular Properties
| Compound Name | 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea |
| PubChem CID | 108910719 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea |
| SMILES | CC/C=C/NC(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C11H22N2O3/c1-4-5-6-12-11(14)13(7-9-15-2)8-10-16-3/h5-6H,4,7-10H2,1-3H3,(H,12,14)/b6-5+ |
| InChIKey | XHRYULOEGRWXIK-AATRIKPKSA-N |
| XLogP | 1.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea?
The IUPAC name of 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea (CID 108910719) is 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea.
What is the SMILES notation for 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea?
The canonical SMILES for 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea is CC/C=C/NC(=O)N(CCOC)CCOC.
What is the InChIKey of 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea?
The InChIKey is XHRYULOEGRWXIK-AATRIKPKSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-4-5-6-12-11(14)13(7-9-15-2)8-10-16-3/h5-6H,4,7-10H2,1-3H3,(H,12,14)/b6-5+.
What are the key properties of 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea?
3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea has a molecular weight of 230.31 g/mol, XLogP of 1.21, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-1-enyl]-1,1-bis(2-methoxyethyl)urea is sourced from PubChem (CID 108910719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).