About O-(2,4,6-trichlorophenyl) chloromethanethioate
O-(2,4,6-trichlorophenyl) chloromethanethioate (PubChem CID 10891109) has the molecular formula C7H2Cl4OS
and a molecular weight of 275.97 g/mol. Its IUPAC name is O-(2,4,6-trichlorophenyl) chloromethanethioate.
Molecular Properties
| Compound Name | O-(2,4,6-trichlorophenyl) chloromethanethioate |
| PubChem CID | 10891109 |
| Molecular Formula | C7H2Cl4OS |
| Molecular Weight | 275.97 g/mol |
| Exact Mass | 273.86 |
| IUPAC Name | O-(2,4,6-trichlorophenyl) chloromethanethioate |
| SMILES | S=C(Cl)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H2Cl4OS/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H |
| InChIKey | KCUPMEKDPZGHOL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2,4,6-trichlorophenyl) chloromethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,4,6-trichlorophenyl) chloromethanethioate?
The IUPAC name of O-(2,4,6-trichlorophenyl) chloromethanethioate (CID 10891109) is O-(2,4,6-trichlorophenyl) chloromethanethioate.
What is the SMILES notation for O-(2,4,6-trichlorophenyl) chloromethanethioate?
The canonical SMILES for O-(2,4,6-trichlorophenyl) chloromethanethioate is S=C(Cl)Oc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of O-(2,4,6-trichlorophenyl) chloromethanethioate?
The InChIKey is KCUPMEKDPZGHOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl4OS/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H.
What are the key properties of O-(2,4,6-trichlorophenyl) chloromethanethioate?
O-(2,4,6-trichlorophenyl) chloromethanethioate has a molecular weight of 275.97 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,4,6-trichlorophenyl) chloromethanethioate is sourced from PubChem (CID 10891109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).