C16H20O4 — CID 10891122
dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3-methylbuta-1,2-dienyl)propanedioate (PubChem CID 10891122) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3-methylbuta-1,2-dienyl)propanedioate.
| Compound Name | dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3-methylbuta-1,2-dienyl)propanedioate |
|---|---|
| PubChem CID | 10891122 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3-methylbuta-1,2-dienyl)propanedioate |
| SMILES | COC(=O)C(C=C=C(C)C)(C(=O)OC)C1C=CC=CC1 |
| InChI | InChI=1S/C16H20O4/c1-12(2)10-11-16(14(17)19-3,15(18)20-4)13-8-6-5-7-9-13/h5-8,11,13H,9H2,1-4H3 |
| InChIKey | IYEJPUXXKXYIRS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|