About 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea
1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea (PubChem CID 108911290) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea.
Molecular Properties
| Compound Name | 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea |
| PubChem CID | 108911290 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N/C=C/C(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)5-6-11-9(13)12-7-8-14-4/h5-6H,7-8H2,1-4H3,(H2,11,12,13)/b6-5+ |
| InChIKey | ABSSGHSYFIHRNA-AATRIKPKSA-N |
| XLogP | 1.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea?
The IUPAC name of 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea (CID 108911290) is 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea.
What is the SMILES notation for 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea?
The canonical SMILES for 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea is COCCNC(=O)N/C=C/C(C)(C)C.
What is the InChIKey of 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea?
The InChIKey is ABSSGHSYFIHRNA-AATRIKPKSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-10(2,3)5-6-11-9(13)12-7-8-14-4/h5-6H,7-8H2,1-4H3,(H2,11,12,13)/b6-5+.
What are the key properties of 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea?
1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea has a molecular weight of 200.28 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea is sourced from PubChem (CID 108911290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).