C16H21BrN2O — CID 108912711
1-[2-(4-bromophenyl)ethyl]-3-(cyclohexylidenemethyl)urea (PubChem CID 108912711) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-3-(cyclohexylidenemethyl)urea.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-3-(cyclohexylidenemethyl)urea |
|---|---|
| PubChem CID | 108912711 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-3-(cyclohexylidenemethyl)urea |
| SMILES | O=C(NC=C1CCCCC1)NCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H21BrN2O/c17-15-8-6-13(7-9-15)10-11-18-16(20)19-12-14-4-2-1-3-5-14/h6-9,12H,1-5,10-11H2,(H2,18,19,20) |
| InChIKey | BYZACVHBTZBDBX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |