C13H22N2O3 — CID 108913093
2,6-dimethyl-N-(oxan-4-ylidenemethyl)morpholine-4-carboxamide (PubChem CID 108913093) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2,6-dimethyl-N-(oxan-4-ylidenemethyl)morpholine-4-carboxamide.
| Compound Name | 2,6-dimethyl-N-(oxan-4-ylidenemethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 108913093 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2,6-dimethyl-N-(oxan-4-ylidenemethyl)morpholine-4-carboxamide |
| SMILES | CC1CN(C(=O)NC=C2CCOCC2)CC(C)O1 |
| InChI | InChI=1S/C13H22N2O3/c1-10-8-15(9-11(2)18-10)13(16)14-7-12-3-5-17-6-4-12/h7,10-11H,3-6,8-9H2,1-2H3,(H,14,16) |
| InChIKey | SSYORJNZSWAUJD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |