About 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea
3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea (PubChem CID 108913175) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 108913175 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NC=C1CCOCC1 |
| InChI | InChI=1S/C13H20N2O2/c1-3-7-15(8-4-2)13(16)14-11-12-5-9-17-10-6-12/h3-4,11H,1-2,5-10H2,(H,14,16) |
| InChIKey | IJJRCVKRZNJOQU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea (CID 108913175) is 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)NC=C1CCOCC1.
What is the InChIKey of 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea?
The InChIKey is IJJRCVKRZNJOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-3-7-15(8-4-2)13(16)14-11-12-5-9-17-10-6-12/h3-4,11H,1-2,5-10H2,(H,14,16).
What are the key properties of 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea?
3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea has a molecular weight of 236.31 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-ylidenemethyl)-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 108913175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).