C18H23NO2 — CID 10891436
(1S)-N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-amine (PubChem CID 10891436) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1S)-N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-amine.
| Compound Name | (1S)-N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 10891436 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1S)-N-benzyl-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-amine |
| SMILES | C#CC[C@H](NCc1ccccc1)[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C18H23NO2/c1-5-10-15(19-13-14-11-8-7-9-12-14)17-16(6-2)20-18(3,4)21-17/h1,6-9,11-12,15-17,19H,2,10,13H2,3-4H3/t15-,16+,17-/m0/s1 |
| InChIKey | LWTCJDZOBAWXIK-BBWFWOEESA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|