C24H31N3O — CID 108914590
4-benzhydryl-N-[(E)-2,3-dimethylbut-1-enyl]piperazine-1-carboxamide (PubChem CID 108914590) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-benzhydryl-N-[(E)-2,3-dimethylbut-1-enyl]piperazine-1-carboxamide.
| Compound Name | 4-benzhydryl-N-[(E)-2,3-dimethylbut-1-enyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108914590 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 4-benzhydryl-N-[(E)-2,3-dimethylbut-1-enyl]piperazine-1-carboxamide |
| SMILES | C/C(=C\NC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)C(C)C |
| InChI | InChI=1S/C24H31N3O/c1-19(2)20(3)18-25-24(28)27-16-14-26(15-17-27)23(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,18-19,23H,14-17H2,1-3H3,(H,25,28)/b20-18+ |
| InChIKey | QDFPTNIOOOAUOO-CZIZESTLSA-N |
| XLogP | 4.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |