C11H20N2O2 — CID 108914620
N-[(E)-2,3-dimethylbut-1-enyl]morpholine-4-carboxamide (PubChem CID 108914620) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[(E)-2,3-dimethylbut-1-enyl]morpholine-4-carboxamide.
| Compound Name | N-[(E)-2,3-dimethylbut-1-enyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 108914620 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[(E)-2,3-dimethylbut-1-enyl]morpholine-4-carboxamide |
| SMILES | C/C(=C\NC(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-9(2)10(3)8-12-11(14)13-4-6-15-7-5-13/h8-9H,4-7H2,1-3H3,(H,12,14)/b10-8+ |
| InChIKey | NXLBHWPXUQIVIG-CSKARUKUSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |