About 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea
1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea (PubChem CID 108914760) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea |
| PubChem CID | 108914760 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea |
| SMILES | C/C(=C\NC(=O)NCCO)C(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-7(2)8(3)6-11-9(13)10-4-5-12/h6-7,12H,4-5H2,1-3H3,(H2,10,11,13)/b8-6+ |
| InChIKey | PFZBVGWYBZJVEE-SOFGYWHQSA-N |
| XLogP | 0.84 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea?
The IUPAC name of 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea (CID 108914760) is 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea.
What is the SMILES notation for 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea?
The canonical SMILES for 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea is C/C(=C\NC(=O)NCCO)C(C)C.
What is the InChIKey of 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea?
The InChIKey is PFZBVGWYBZJVEE-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-7(2)8(3)6-11-9(13)10-4-5-12/h6-7,12H,4-5H2,1-3H3,(H2,10,11,13)/b8-6+.
What are the key properties of 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea?
1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea has a molecular weight of 186.25 g/mol, XLogP of 0.84, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-hydroxyethyl)urea is sourced from PubChem (CID 108914760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).