C15H21ClN2O — CID 108914972
1-[(2-chlorophenyl)methyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea (PubChem CID 108914972) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108914972 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
| SMILES | C/C(=C\NC(=O)NCc1ccccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H21ClN2O/c1-11(15(2,3)4)9-17-14(19)18-10-12-7-5-6-8-13(12)16/h5-9H,10H2,1-4H3,(H2,17,18,19)/b11-9+ |
| InChIKey | UCSUIYNMMZDDPY-PKNBQFBNSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |