C14H30O4Si — CID 10891600
[(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]methanol (PubChem CID 10891600) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]methanol.
| Compound Name | [(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 10891600 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [(2S,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyloxan-2-yl]methanol |
| SMILES | CO[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)OC[C@@H]1C |
| InChI | InChI=1S/C14H30O4Si/c1-10-9-17-11(8-15)13(12(10)16-5)18-19(6,7)14(2,3)4/h10-13,15H,8-9H2,1-7H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | YBKKNJZOTAHCLV-CYDGBPFRSA-N |
| XLogP | 2.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|