C19H19NO2 — CID 10891696
(8aS)-1,1-diphenyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-4-one (PubChem CID 10891696) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (8aS)-1,1-diphenyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-4-one.
| Compound Name | (8aS)-1,1-diphenyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 10891696 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (8aS)-1,1-diphenyl-6,7,8,8a-tetrahydropyrrolo[2,1-c][1,4]oxazin-4-one |
| SMILES | O=C1COC(c2ccccc2)(c2ccccc2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C19H19NO2/c21-18-14-22-19(15-8-3-1-4-9-15,16-10-5-2-6-11-16)17-12-7-13-20(17)18/h1-6,8-11,17H,7,12-14H2/t17-/m0/s1 |
| InChIKey | NIPCLOORKPRVQF-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |