C22H26ClN3O4 — CID 108917038
tert-butyl N-[2-[4-[3-(3-chlorophenyl)propanoylamino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917038) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[3-(3-chlorophenyl)propanoylamino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[3-(3-chlorophenyl)propanoylamino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917038 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | tert-butyl N-[2-[4-[3-(3-chlorophenyl)propanoylamino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(NC(=O)CCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H26ClN3O4/c1-22(2,3)30-21(29)24-14-20(28)26-18-10-8-17(9-11-18)25-19(27)12-7-15-5-4-6-16(23)13-15/h4-6,8-11,13H,7,12,14H2,1-3H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | UKYSXTIJABVTQS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |