About methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate
methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate (PubChem CID 10891754) has the molecular formula C14H17NO4S
and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate |
| PubChem CID | 10891754 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\[C@@H]1[C@H](C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17NO4S/c1-10-4-6-12(7-5-10)20(17,18)15-11(2)13(15)8-9-14(16)19-3/h4-9,11,13H,1-3H3/b9-8-/t11-,13+,15?/m0/s1 |
| InChIKey | CCBZBLUNHZKKAA-MBGNOEIWSA-N |
| XLogP | 1.49 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate?
The IUPAC name of methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate (CID 10891754) is methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate.
What is the SMILES notation for methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate?
The canonical SMILES for methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate is COC(=O)/C=C\[C@@H]1[C@H](C)N1S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate?
The InChIKey is CCBZBLUNHZKKAA-MBGNOEIWSA-N. The full InChI is InChI=1S/C14H17NO4S/c1-10-4-6-12(7-5-10)20(17,18)15-11(2)13(15)8-9-14(16)19-3/h4-9,11,13H,1-3H3/b9-8-/t11-,13+,15?/m0/s1.
What are the key properties of methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate?
methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate has a molecular weight of 295.36 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-[(2R,3S)-3-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]prop-2-enoate is sourced from PubChem (CID 10891754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).