C23H29N3O5 — CID 108917576
tert-butyl N-[2-[4-[[(4-ethoxybenzoyl)amino]methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 108917576) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[(4-ethoxybenzoyl)amino]methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[(4-ethoxybenzoyl)amino]methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917576 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl N-[2-[4-[[(4-ethoxybenzoyl)amino]methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | CCOc1ccc(C(=O)NCc2ccc(NC(=O)CNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-5-30-19-12-8-17(9-13-19)21(28)24-14-16-6-10-18(11-7-16)26-20(27)15-25-22(29)31-23(2,3)4/h6-13H,5,14-15H2,1-4H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | PITAVFHMOYJJMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |