C20H24O2 — CID 10891786
4-methyl-2-(2,4,4,6-tetramethyl-3H-chromen-2-yl)phenol (PubChem CID 10891786) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-methyl-2-(2,4,4,6-tetramethyl-3H-chromen-2-yl)phenol.
| Compound Name | 4-methyl-2-(2,4,4,6-tetramethyl-3H-chromen-2-yl)phenol |
|---|---|
| PubChem CID | 10891786 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 4-methyl-2-(2,4,4,6-tetramethyl-3H-chromen-2-yl)phenol |
| SMILES | Cc1ccc2c(c1)C(C)(C)CC(C)(c1cc(C)ccc1O)O2 |
| InChI | InChI=1S/C20H24O2/c1-13-6-8-17(21)15(10-13)20(5)12-19(3,4)16-11-14(2)7-9-18(16)22-20/h6-11,21H,12H2,1-5H3 |
| InChIKey | ICOGTSGDFNRIBK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |