C14H19BrO2 — CID 10891879
(1R,5S,8R)-8-[(E)-4-bromo-3-methylbut-2-enyl]-1-hydroxy-8-methylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 10891879) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is (1R,5S,8R)-8-[(E)-4-bromo-3-methylbut-2-enyl]-1-hydroxy-8-methylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5S,8R)-8-[(E)-4-bromo-3-methylbut-2-enyl]-1-hydroxy-8-methylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 10891879 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1R,5S,8R)-8-[(E)-4-bromo-3-methylbut-2-enyl]-1-hydroxy-8-methylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C/C(=C\C[C@]1(C)[C@@H]2C=CC(=O)[C@@]1(O)CC2)CBr |
| InChI | InChI=1S/C14H19BrO2/c1-10(9-15)5-7-13(2)11-3-4-12(16)14(13,17)8-6-11/h3-5,11,17H,6-9H2,1-2H3/b10-5+/t11-,13-,14+/m1/s1 |
| InChIKey | IRGJTIVBEMNEEF-FVWHFSBDSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|