C18H36O3 — CID 10891946
(Z)-12,12-di(propan-2-yloxy)dodec-9-en-1-ol (PubChem CID 10891946) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is (Z)-12,12-di(propan-2-yloxy)dodec-9-en-1-ol.
| Compound Name | (Z)-12,12-di(propan-2-yloxy)dodec-9-en-1-ol |
|---|---|
| PubChem CID | 10891946 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | (Z)-12,12-di(propan-2-yloxy)dodec-9-en-1-ol |
| SMILES | CC(C)OC(C/C=C\CCCCCCCCO)OC(C)C |
| InChI | InChI=1S/C18H36O3/c1-16(2)20-18(21-17(3)4)14-12-10-8-6-5-7-9-11-13-15-19/h10,12,16-19H,5-9,11,13-15H2,1-4H3/b12-10- |
| InChIKey | MCFQYROJDODUTN-BENRWUELSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|