C15H26O6 — CID 10891986
2-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioic acid (PubChem CID 10891986) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioic acid.
| Compound Name | 2-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioic acid |
|---|---|
| PubChem CID | 10891986 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-methyl-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioic acid |
| SMILES | CC(C)(C)OC(=O)CCC(C)(CCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26O6/c1-14(2,3)21-12(18)8-10-15(4,13(19)20)9-6-5-7-11(16)17/h5-10H2,1-4H3,(H,16,17)(H,19,20) |
| InChIKey | DMFROGVPCUZJMC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|