C9H8Br2N2 — CID 10892031
(1R,8S,9S,10R)-9,10-dibromo-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 10892031) has the molecular formula C9H8Br2N2 and a molecular weight of 303.99 g/mol. Its IUPAC name is (1R,8S,9S,10R)-9,10-dibromo-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S,9S,10R)-9,10-dibromo-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 10892031 |
| Molecular Formula | C9H8Br2N2 |
| Molecular Weight | 303.99 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | (1R,8S,9S,10R)-9,10-dibromo-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Br[C@@H]1[C@H](Br)[C@@H]2C[C@H]1c1nccnc12 |
| InChI | InChI=1S/C9H8Br2N2/c10-6-4-3-5(7(6)11)9-8(4)12-1-2-13-9/h1-2,4-7H,3H2/t4-,5+,6+,7- |
| InChIKey | JSUTYSFXSDTVNI-RNGGSSJXSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.99 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|