C18H24O4 — CID 10892048
dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3,4-dimethylpenta-1,2-dienyl)propanedioate (PubChem CID 10892048) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3,4-dimethylpenta-1,2-dienyl)propanedioate.
| Compound Name | dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3,4-dimethylpenta-1,2-dienyl)propanedioate |
|---|---|
| PubChem CID | 10892048 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | dimethyl 2-cyclohexa-2,4-dien-1-yl-2-(3,4-dimethylpenta-1,2-dienyl)propanedioate |
| SMILES | COC(=O)C(C=C=C(C)C(C)C)(C(=O)OC)C1C=CC=CC1 |
| InChI | InChI=1S/C18H24O4/c1-13(2)14(3)11-12-18(16(19)21-4,17(20)22-5)15-9-7-6-8-10-15/h6-9,12-13,15H,10H2,1-5H3 |
| InChIKey | PIDDMNUBXBHYJQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|