C9H13ClN6O2S — CID 10892077
(NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 10892077) has the molecular formula C9H13ClN6O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 10892077 |
| Molecular Formula | C9H13ClN6O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (NE)-N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CN1CN(C)/C(=N\[N+](=O)[O-])N(Cc2cnc(Cl)s2)C1 |
| InChI | InChI=1S/C9H13ClN6O2S/c1-13-5-14(2)9(12-16(17)18)15(6-13)4-7-3-11-8(10)19-7/h3H,4-6H2,1-2H3/b12-9+ |
| InChIKey | NRPCZWUIOZTKHN-FMIVXFBMSA-N |
| XLogP | 0.94 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|