About [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate (PubChem CID 10892092) has the molecular formula C14H15N3O3S
and a molecular weight of 305.36 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate |
| PubChem CID | 10892092 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cccnc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H15N3O3S/c1-14(2,3)12(19)20-9-5-4-6-15-10(9)11(18)17-13-16-7-8-21-13/h4-8H,1-3H3,(H,16,17,18) |
| InChIKey | PXPFFSRMMODNKS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate (CID 10892092) is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)Oc1cccnc1C(=O)Nc1nccs1.
What is the InChIKey of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate?
The InChIKey is PXPFFSRMMODNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3S/c1-14(2,3)12(19)20-9-5-4-6-15-10(9)11(18)17-13-16-7-8-21-13/h4-8H,1-3H3,(H,16,17,18).
What are the key properties of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate?
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate has a molecular weight of 305.36 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 10892092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).