C30H36N4O6 — CID 108921237
tert-butyl N-[3-[[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 108921237) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921237 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | tert-butyl N-[3-[[3-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1cccc(NC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1 |
| InChI | InChI=1S/C30H36N4O6/c1-30(2,3)40-29(39)31-15-14-25(35)32-18-19-8-7-9-21(16-19)33-26(36)20-12-13-23-24(17-20)28(38)34(27(23)37)22-10-5-4-6-11-22/h7-9,12-13,16-17,22H,4-6,10-11,14-15,18H2,1-3H3,(H,31,39)(H,32,35)(H,33,36) |
| InChIKey | YWCFWZRWFBFFCB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|