C20H22N2O — CID 10892139
2-(3-phenoxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 10892139) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(3-phenoxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-(3-phenoxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10892139 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-(3-phenoxypropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | c1ccc(OCCCN2CCc3c([nH]c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C20H22N2O/c1-2-7-16(8-3-1)23-14-6-12-22-13-11-18-17-9-4-5-10-19(17)21-20(18)15-22/h1-5,7-10,21H,6,11-15H2 |
| InChIKey | KFEQSXYFANTPFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|