C18H31N3O4 — CID 108921729
tert-butyl N-[3-[3-[[(E)-3-cyclopropylbut-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate (PubChem CID 108921729) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[(E)-3-cyclopropylbut-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[(E)-3-cyclopropylbut-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921729 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | tert-butyl N-[3-[3-[[(E)-3-cyclopropylbut-2-enoyl]amino]propylamino]-3-oxopropyl]carbamate |
| SMILES | C/C(=C\C(=O)NCCCNC(=O)CCNC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C18H31N3O4/c1-13(14-6-7-14)12-16(23)20-10-5-9-19-15(22)8-11-21-17(24)25-18(2,3)4/h12,14H,5-11H2,1-4H3,(H,19,22)(H,20,23)(H,21,24)/b13-12+ |
| InChIKey | QOQWWABDYLAEPB-OUKQBFOZSA-N |
| XLogP | 1.88 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|