C14H17ClN4O3 — CID 1089220
N-(3-chloro-4-methoxyphenyl)-4,6-diethoxy-1,3,5-triazin-2-amine (PubChem CID 1089220) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4,6-diethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4,6-diethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1089220 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4,6-diethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Nc2ccc(OC)c(Cl)c2)nc(OCC)n1 |
| InChI | InChI=1S/C14H17ClN4O3/c1-4-21-13-17-12(18-14(19-13)22-5-2)16-9-6-7-11(20-3)10(15)8-9/h6-8H,4-5H2,1-3H3,(H,16,17,18,19) |
| InChIKey | HUQUQRMXRCGVHV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |