About (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane
(2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane (PubChem CID 10892229) has the molecular formula C17H15ClF2O
and a molecular weight of 308.76 g/mol. Its IUPAC name is (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane.
Molecular Properties
| Compound Name | (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane |
| PubChem CID | 10892229 |
| Molecular Formula | C17H15ClF2O |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane |
| SMILES | Fc1ccc([C@@H]2CC(Cl)C[C@H](c3ccc(F)cc3)O2)cc1 |
| InChI | InChI=1S/C17H15ClF2O/c18-13-9-16(11-1-5-14(19)6-2-11)21-17(10-13)12-3-7-15(20)8-4-12/h1-8,13,16-17H,9-10H2/t13?,16-,17+ |
| InChIKey | APXUZUXZIDOLEF-FUCXHRTASA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane?
The IUPAC name of (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane (CID 10892229) is (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane.
What is the SMILES notation for (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane?
The canonical SMILES for (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane is Fc1ccc([C@@H]2CC(Cl)C[C@H](c3ccc(F)cc3)O2)cc1.
What is the InChIKey of (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane?
The InChIKey is APXUZUXZIDOLEF-FUCXHRTASA-N. The full InChI is InChI=1S/C17H15ClF2O/c18-13-9-16(11-1-5-14(19)6-2-11)21-17(10-13)12-3-7-15(20)8-4-12/h1-8,13,16-17H,9-10H2/t13?,16-,17+.
What are the key properties of (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane?
(2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane has a molecular weight of 308.76 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane is sourced from PubChem (CID 10892229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).