C17H15ClF2O — CID 10892229
(2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane (PubChem CID 10892229) has the molecular formula C17H15ClF2O and a molecular weight of 308.76 g/mol. Its IUPAC name is (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane.
| Compound Name | (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane |
|---|---|
| PubChem CID | 10892229 |
| Molecular Formula | C17H15ClF2O |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2R,6S)-4-chloro-2,6-bis(4-fluorophenyl)oxane |
| SMILES | Fc1ccc([C@@H]2CC(Cl)C[C@H](c3ccc(F)cc3)O2)cc1 |
| InChI | InChI=1S/C17H15ClF2O/c18-13-9-16(11-1-5-14(19)6-2-11)21-17(10-13)12-3-7-15(20)8-4-12/h1-8,13,16-17H,9-10H2/t13?,16-,17+ |
| InChIKey | APXUZUXZIDOLEF-FUCXHRTASA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|