C17H27N3O2 — CID 108922316
(E)-N-[[1-(2-cyanoacetyl)piperidin-4-yl]methyl]-3,4,4-trimethylpent-2-enamide (PubChem CID 108922316) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (E)-N-[[1-(2-cyanoacetyl)piperidin-4-yl]methyl]-3,4,4-trimethylpent-2-enamide.
| Compound Name | (E)-N-[[1-(2-cyanoacetyl)piperidin-4-yl]methyl]-3,4,4-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 108922316 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (E)-N-[[1-(2-cyanoacetyl)piperidin-4-yl]methyl]-3,4,4-trimethylpent-2-enamide |
| SMILES | C/C(=C\C(=O)NCC1CCN(C(=O)CC#N)CC1)C(C)(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-13(17(2,3)4)11-15(21)19-12-14-6-9-20(10-7-14)16(22)5-8-18/h11,14H,5-7,9-10,12H2,1-4H3,(H,19,21)/b13-11+ |
| InChIKey | KJMVZOSJJZCUTR-ACCUITESSA-N |
| XLogP | 2.25 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|