About [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate (PubChem CID 1089231) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate.
Molecular Properties
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate |
| PubChem CID | 1089231 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c18-14-7-3-2-6-13(14)17(21)22-11-16(20)19-10-9-12-5-1-4-8-15(12)19/h1-8H,9-11,18H2 |
| InChIKey | DVRFPRUTOAQODO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate?
The IUPAC name of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate (CID 1089231) is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate.
What is the SMILES notation for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate?
The canonical SMILES for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate is Nc1ccccc1C(=O)OCC(=O)N1CCc2ccccc21.
What is the InChIKey of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate?
The InChIKey is DVRFPRUTOAQODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3/c18-14-7-3-2-6-13(14)17(21)22-11-16(20)19-10-9-12-5-1-4-8-15(12)19/h1-8H,9-11,18H2.
What are the key properties of [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate?
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate has a molecular weight of 296.33 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-aminobenzoate is sourced from PubChem (CID 1089231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).