C19H25NOSi — CID 10892320
10b-(4-trimethylsilylbut-3-ynyl)-1,2,3,4-tetrahydropyrido[2,1-a]isoindol-6-one (PubChem CID 10892320) has the molecular formula C19H25NOSi and a molecular weight of 311.50 g/mol. Its IUPAC name is 10b-(4-trimethylsilylbut-3-ynyl)-1,2,3,4-tetrahydropyrido[2,1-a]isoindol-6-one.
| Compound Name | 10b-(4-trimethylsilylbut-3-ynyl)-1,2,3,4-tetrahydropyrido[2,1-a]isoindol-6-one |
|---|---|
| PubChem CID | 10892320 |
| Molecular Formula | C19H25NOSi |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 10b-(4-trimethylsilylbut-3-ynyl)-1,2,3,4-tetrahydropyrido[2,1-a]isoindol-6-one |
| SMILES | C[Si](C)(C)C#CCCC12CCCCN1C(=O)c1ccccc12 |
| InChI | InChI=1S/C19H25NOSi/c1-22(2,3)15-9-7-13-19-12-6-8-14-20(19)18(21)16-10-4-5-11-17(16)19/h4-5,10-11H,6-8,12-14H2,1-3H3 |
| InChIKey | FZGPWDASTLQSHV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|