C15H20O7 — CID 10892330
dimethyl (1S,4S,5S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate (PubChem CID 10892330) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is dimethyl (1S,4S,5S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate.
| Compound Name | dimethyl (1S,4S,5S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10892330 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | dimethyl (1S,4S,5S)-7,7-dimethoxy-5-methyl-8-oxobicyclo[2.2.2]oct-2-ene-2,5-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=O)C(OC)(OC)[C@H]1C[C@]2(C)C(=O)OC |
| InChI | InChI=1S/C15H20O7/c1-14(13(18)20-3)7-10-8(12(17)19-2)6-9(14)11(16)15(10,21-4)22-5/h6,9-10H,7H2,1-5H3/t9-,10+,14+/m1/s1 |
| InChIKey | AEWHYDKQNQHNMJ-BFVZDQMLSA-N |
| XLogP | 0.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|