C17H19N3O2 — CID 108923438
(E)-N-[4-[[(2-cyanoacetyl)amino]methyl]phenyl]-3-cyclopropylbut-2-enamide (PubChem CID 108923438) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is (E)-N-[4-[[(2-cyanoacetyl)amino]methyl]phenyl]-3-cyclopropylbut-2-enamide.
| Compound Name | (E)-N-[4-[[(2-cyanoacetyl)amino]methyl]phenyl]-3-cyclopropylbut-2-enamide |
|---|---|
| PubChem CID | 108923438 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (E)-N-[4-[[(2-cyanoacetyl)amino]methyl]phenyl]-3-cyclopropylbut-2-enamide |
| SMILES | C/C(=C\C(=O)Nc1ccc(CNC(=O)CC#N)cc1)C1CC1 |
| InChI | InChI=1S/C17H19N3O2/c1-12(14-4-5-14)10-17(22)20-15-6-2-13(3-7-15)11-19-16(21)8-9-18/h2-3,6-7,10,14H,4-5,8,11H2,1H3,(H,19,21)(H,20,22)/b12-10+ |
| InChIKey | AFEXKXNKGUCSFO-ZRDIBKRKSA-N |
| XLogP | 2.51 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|