C20H20ClN3O3 — CID 108923588
4-(2-chlorophenoxy)-N-[[2-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide (PubChem CID 108923588) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-[[2-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide.
| Compound Name | 4-(2-chlorophenoxy)-N-[[2-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 108923588 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-[[2-[(2-cyanoacetyl)amino]phenyl]methyl]butanamide |
| SMILES | N#CCC(=O)Nc1ccccc1CNC(=O)CCCOc1ccccc1Cl |
| InChI | InChI=1S/C20H20ClN3O3/c21-16-7-2-4-9-18(16)27-13-5-10-19(25)23-14-15-6-1-3-8-17(15)24-20(26)11-12-22/h1-4,6-9H,5,10-11,13-14H2,(H,23,25)(H,24,26) |
| InChIKey | BNRIGKUTHPPRHZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|