C16H21N3O2 — CID 108924383
N-[3-[(2-cyanoacetyl)amino]propyl]-3-(2-methylphenyl)propanamide (PubChem CID 108924383) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[3-[(2-cyanoacetyl)amino]propyl]-3-(2-methylphenyl)propanamide.
| Compound Name | N-[3-[(2-cyanoacetyl)amino]propyl]-3-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 108924383 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[3-[(2-cyanoacetyl)amino]propyl]-3-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1CCC(=O)NCCCNC(=O)CC#N |
| InChI | InChI=1S/C16H21N3O2/c1-13-5-2-3-6-14(13)7-8-15(20)18-11-4-12-19-16(21)9-10-17/h2-3,5-6H,4,7-9,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | QSAQUHCSVYYBJR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|