C20H22FN3O2 — CID 108924769
2-(3-fluorophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]acetamide (PubChem CID 108924769) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 108924769 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]acetamide |
| SMILES | O=C(Cc1cccc(F)c1)NCC1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c21-18-5-1-3-16(11-18)12-19(25)23-13-15-6-9-24(10-7-15)20(26)17-4-2-8-22-14-17/h1-5,8,11,14-15H,6-7,9-10,12-13H2,(H,23,25) |
| InChIKey | IVHOPVAXEIMRIK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |